C17H23ClN4O2S — CID 137146533
2-[[3-(2-methylpiperazin-1-yl)-3-oxopropyl]sulfanylmethyl]-3H-quinazolin-4-one;hydrochloride (PubChem CID 137146533) has the molecular formula C17H23ClN4O2S and a molecular weight of 382.92 g/mol. Its IUPAC name is 2-[[3-(2-methylpiperazin-1-yl)-3-oxopropyl]sulfanylmethyl]-3H-quinazolin-4-one;hydrochloride.
| Compound Name | 2-[[3-(2-methylpiperazin-1-yl)-3-oxopropyl]sulfanylmethyl]-3H-quinazolin-4-one;hydrochloride |
|---|---|
| PubChem CID | 137146533 |
| Molecular Formula | C17H23ClN4O2S |
| Molecular Weight | 382.92 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | 2-[[3-(2-methylpiperazin-1-yl)-3-oxopropyl]sulfanylmethyl]-3H-quinazolin-4-one;hydrochloride |
| SMILES | CC1CNCCN1C(=O)CCSCc1nc2ccccc2c(=O)[nH]1.Cl |
| InChI | InChI=1S/C17H22N4O2S.ClH/c1-12-10-18-7-8-21(12)16(22)6-9-24-11-15-19-14-5-3-2-4-13(14)17(23)20-15;/h2-5,12,18H,6-11H2,1H3,(H,19,20,23);1H |
| InChIKey | IUKWFNMIFMKDEZ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.92 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|