C20H22N4 — CID 136664139
(5S,7R)-5-(4-ethylphenyl)-7-(2-methylphenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 136664139) has the molecular formula C20H22N4 and a molecular weight of 318.42 g/mol. Its IUPAC name is (5S,7R)-5-(4-ethylphenyl)-7-(2-methylphenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine.
| Compound Name | (5S,7R)-5-(4-ethylphenyl)-7-(2-methylphenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 136664139 |
| Molecular Formula | C20H22N4 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | (5S,7R)-5-(4-ethylphenyl)-7-(2-methylphenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | CCc1ccc([C@@H]2C[C@H](c3ccccc3C)n3ncnc3N2)cc1 |
| InChI | InChI=1S/C20H22N4/c1-3-15-8-10-16(11-9-15)18-12-19(17-7-5-4-6-14(17)2)24-20(23-18)21-13-22-24/h4-11,13,18-19H,3,12H2,1-2H3,(H,21,22,23)/t18-,19+/m0/s1 |
| InChIKey | MJXWIVCOGXBIOV-RBUKOAKNSA-N |
| XLogP | 4.30 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |