C19H20N4O — CID 931887
(5R,7R)-7-(2-ethoxyphenyl)-5-phenyl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 931887) has the molecular formula C19H20N4O and a molecular weight of 320.40 g/mol. Its IUPAC name is (5R,7R)-7-(2-ethoxyphenyl)-5-phenyl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine.
| Compound Name | (5R,7R)-7-(2-ethoxyphenyl)-5-phenyl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 931887 |
| Molecular Formula | C19H20N4O |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | (5R,7R)-7-(2-ethoxyphenyl)-5-phenyl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | CCOc1ccccc1[C@H]1C[C@H](c2ccccc2)Nc2ncnn21 |
| InChI | InChI=1S/C19H20N4O/c1-2-24-18-11-7-6-10-15(18)17-12-16(14-8-4-3-5-9-14)22-19-20-13-21-23(17)19/h3-11,13,16-17H,2,12H2,1H3,(H,20,21,22)/t16-,17-/m1/s1 |
| InChIKey | IVRXOQCOHPCQKZ-IAGOWNOFSA-N |
| XLogP | 3.82 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |