C15H10FN3O — CID 136668740
2-(3-fluorophenyl)-4-pyridin-3-yl-1H-pyrimidin-6-one (PubChem CID 136668740) has the molecular formula C15H10FN3O and a molecular weight of 267.26 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-4-pyridin-3-yl-1H-pyrimidin-6-one.
| Compound Name | 2-(3-fluorophenyl)-4-pyridin-3-yl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136668740 |
| Molecular Formula | C15H10FN3O |
| Molecular Weight | 267.26 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | 2-(3-fluorophenyl)-4-pyridin-3-yl-1H-pyrimidin-6-one |
| SMILES | O=c1cc(-c2cccnc2)nc(-c2cccc(F)c2)[nH]1 |
| InChI | InChI=1S/C15H10FN3O/c16-12-5-1-3-10(7-12)15-18-13(8-14(20)19-15)11-4-2-6-17-9-11/h1-9H,(H,18,19,20) |
| InChIKey | HTQYZFWHQDCBDP-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.26 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |