C14H15N5OS — CID 136670219
6-amino-7-[1-(5-methyl-1,3-thiazol-2-yl)ethylamino]-3H-quinazolin-4-one (PubChem CID 136670219) has the molecular formula C14H15N5OS and a molecular weight of 301.38 g/mol. Its IUPAC name is 6-amino-7-[1-(5-methyl-1,3-thiazol-2-yl)ethylamino]-3H-quinazolin-4-one.
| Compound Name | 6-amino-7-[1-(5-methyl-1,3-thiazol-2-yl)ethylamino]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 136670219 |
| Molecular Formula | C14H15N5OS |
| Molecular Weight | 301.38 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 6-amino-7-[1-(5-methyl-1,3-thiazol-2-yl)ethylamino]-3H-quinazolin-4-one |
| SMILES | Cc1cnc(C(C)Nc2cc3nc[nH]c(=O)c3cc2N)s1 |
| InChI | InChI=1S/C14H15N5OS/c1-7-5-16-14(21-7)8(2)19-12-4-11-9(3-10(12)15)13(20)18-6-17-11/h3-6,8,19H,15H2,1-2H3,(H,17,18,20) |
| InChIKey | PNAOJUMHVQWTKL-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.38 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|