C21H20N6O2 — CID 136671310
2-[1-[6-oxo-2-(1-pyridin-3-ylethylamino)-1H-pyrimidin-4-yl]ethyl]phthalazin-1-one (PubChem CID 136671310) has the molecular formula C21H20N6O2 and a molecular weight of 388.43 g/mol. Its IUPAC name is 2-[1-[6-oxo-2-(1-pyridin-3-ylethylamino)-1H-pyrimidin-4-yl]ethyl]phthalazin-1-one.
| Compound Name | 2-[1-[6-oxo-2-(1-pyridin-3-ylethylamino)-1H-pyrimidin-4-yl]ethyl]phthalazin-1-one |
|---|---|
| PubChem CID | 136671310 |
| Molecular Formula | C21H20N6O2 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 2-[1-[6-oxo-2-(1-pyridin-3-ylethylamino)-1H-pyrimidin-4-yl]ethyl]phthalazin-1-one |
| SMILES | CC(Nc1nc(C(C)n2ncc3ccccc3c2=O)cc(=O)[nH]1)c1cccnc1 |
| InChI | InChI=1S/C21H20N6O2/c1-13(15-7-5-9-22-11-15)24-21-25-18(10-19(28)26-21)14(2)27-20(29)17-8-4-3-6-16(17)12-23-27/h3-14H,1-2H3,(H2,24,25,26,28) |
| InChIKey | CWLBIJXLDWJTNB-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |