C22H21N5O2 — CID 136820167
2-[(1R)-1-[6-oxo-2-[[(1R)-1-phenylethyl]amino]-1H-pyrimidin-4-yl]ethyl]phthalazin-1-one (PubChem CID 136820167) has the molecular formula C22H21N5O2 and a molecular weight of 387.44 g/mol. Its IUPAC name is 2-[(1R)-1-[6-oxo-2-[[(1R)-1-phenylethyl]amino]-1H-pyrimidin-4-yl]ethyl]phthalazin-1-one.
| Compound Name | 2-[(1R)-1-[6-oxo-2-[[(1R)-1-phenylethyl]amino]-1H-pyrimidin-4-yl]ethyl]phthalazin-1-one |
|---|---|
| PubChem CID | 136820167 |
| Molecular Formula | C22H21N5O2 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 2-[(1R)-1-[6-oxo-2-[[(1R)-1-phenylethyl]amino]-1H-pyrimidin-4-yl]ethyl]phthalazin-1-one |
| SMILES | C[C@H](c1cc(=O)[nH]c(N[C@H](C)c2ccccc2)n1)n1ncc2ccccc2c1=O |
| InChI | InChI=1S/C22H21N5O2/c1-14(16-8-4-3-5-9-16)24-22-25-19(12-20(28)26-22)15(2)27-21(29)18-11-7-6-10-17(18)13-23-27/h3-15H,1-2H3,(H2,24,25,26,28)/t14-,15-/m1/s1 |
| InChIKey | CNPWCPJCUQRDIU-HUUCEWRRSA-N |
| XLogP | 3.26 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |