C19H21N5O3 — CID 136820121
2-[(1S)-1-[2-(oxan-4-ylamino)-6-oxo-1H-pyrimidin-4-yl]ethyl]phthalazin-1-one (PubChem CID 136820121) has the molecular formula C19H21N5O3 and a molecular weight of 367.41 g/mol. Its IUPAC name is 2-[(1S)-1-[2-(oxan-4-ylamino)-6-oxo-1H-pyrimidin-4-yl]ethyl]phthalazin-1-one.
| Compound Name | 2-[(1S)-1-[2-(oxan-4-ylamino)-6-oxo-1H-pyrimidin-4-yl]ethyl]phthalazin-1-one |
|---|---|
| PubChem CID | 136820121 |
| Molecular Formula | C19H21N5O3 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 2-[(1S)-1-[2-(oxan-4-ylamino)-6-oxo-1H-pyrimidin-4-yl]ethyl]phthalazin-1-one |
| SMILES | C[C@@H](c1cc(=O)[nH]c(NC2CCOCC2)n1)n1ncc2ccccc2c1=O |
| InChI | InChI=1S/C19H21N5O3/c1-12(24-18(26)15-5-3-2-4-13(15)11-20-24)16-10-17(25)23-19(22-16)21-14-6-8-27-9-7-14/h2-5,10-12,14H,6-9H2,1H3,(H2,21,22,23,25)/t12-/m0/s1 |
| InChIKey | OXCAFIOROAPKBJ-LBPRGKRZSA-N |
| XLogP | 1.68 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |