C20H23N5O3 — CID 136820110
2-[(1R)-1-[2-[[(3R)-oxan-3-yl]methylamino]-6-oxo-1H-pyrimidin-4-yl]ethyl]phthalazin-1-one (PubChem CID 136820110) has the molecular formula C20H23N5O3 and a molecular weight of 381.44 g/mol. Its IUPAC name is 2-[(1R)-1-[2-[[(3R)-oxan-3-yl]methylamino]-6-oxo-1H-pyrimidin-4-yl]ethyl]phthalazin-1-one.
| Compound Name | 2-[(1R)-1-[2-[[(3R)-oxan-3-yl]methylamino]-6-oxo-1H-pyrimidin-4-yl]ethyl]phthalazin-1-one |
|---|---|
| PubChem CID | 136820110 |
| Molecular Formula | C20H23N5O3 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | 2-[(1R)-1-[2-[[(3R)-oxan-3-yl]methylamino]-6-oxo-1H-pyrimidin-4-yl]ethyl]phthalazin-1-one |
| SMILES | C[C@H](c1cc(=O)[nH]c(NC[C@H]2CCCOC2)n1)n1ncc2ccccc2c1=O |
| InChI | InChI=1S/C20H23N5O3/c1-13(25-19(27)16-7-3-2-6-15(16)11-22-25)17-9-18(26)24-20(23-17)21-10-14-5-4-8-28-12-14/h2-3,6-7,9,11,13-14H,4-5,8,10,12H2,1H3,(H2,21,23,24,26)/t13-,14-/m1/s1 |
| InChIKey | LJCYKUZPRVBGSV-ZIAGYGMSSA-N |
| XLogP | 1.93 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |