C21H25F3N4O — CID 136672443
[(2R,5S)-2,5-dimethylpiperidin-1-yl]-[(5R,7S)-5-phenyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]methanone (PubChem CID 136672443) has the molecular formula C21H25F3N4O and a molecular weight of 406.45 g/mol. Its IUPAC name is [(2R,5S)-2,5-dimethylpiperidin-1-yl]-[(5R,7S)-5-phenyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]methanone.
| Compound Name | [(2R,5S)-2,5-dimethylpiperidin-1-yl]-[(5R,7S)-5-phenyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]methanone |
|---|---|
| PubChem CID | 136672443 |
| Molecular Formula | C21H25F3N4O |
| Molecular Weight | 406.45 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | [(2R,5S)-2,5-dimethylpiperidin-1-yl]-[(5R,7S)-5-phenyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]methanone |
| SMILES | C[C@H]1CC[C@@H](C)N(C(=O)c2cc3n(n2)[C@H](C(F)(F)F)C[C@H](c2ccccc2)N3)C1 |
| InChI | InChI=1S/C21H25F3N4O/c1-13-8-9-14(2)27(12-13)20(29)17-11-19-25-16(15-6-4-3-5-7-15)10-18(21(22,23)24)28(19)26-17/h3-7,11,13-14,16,18,25H,8-10,12H2,1-2H3/t13-,14+,16+,18-/m0/s1 |
| InChIKey | SJUIOMIHNPPKAB-MMNPAVHPSA-N |
| XLogP | 4.80 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.45 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |