C20H23F3N4O — CID 136818087
[(2S)-2-methylpiperidin-1-yl]-[(5S,7S)-5-phenyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]methanone (PubChem CID 136818087) has the molecular formula C20H23F3N4O and a molecular weight of 392.43 g/mol. Its IUPAC name is [(2S)-2-methylpiperidin-1-yl]-[(5S,7S)-5-phenyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]methanone.
| Compound Name | [(2S)-2-methylpiperidin-1-yl]-[(5S,7S)-5-phenyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]methanone |
|---|---|
| PubChem CID | 136818087 |
| Molecular Formula | C20H23F3N4O |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | [(2S)-2-methylpiperidin-1-yl]-[(5S,7S)-5-phenyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]methanone |
| SMILES | C[C@H]1CCCCN1C(=O)c1cc2n(n1)[C@H](C(F)(F)F)C[C@@H](c1ccccc1)N2 |
| InChI | InChI=1S/C20H23F3N4O/c1-13-7-5-6-10-26(13)19(28)16-12-18-24-15(14-8-3-2-4-9-14)11-17(20(21,22)23)27(18)25-16/h2-4,8-9,12-13,15,17,24H,5-7,10-11H2,1H3/t13-,15-,17-/m0/s1 |
| InChIKey | MYCAZMDYGQEONG-QRTARXTBSA-N |
| XLogP | 4.56 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |