C23H30FN5O — CID 136673329
7-[(3-fluoro-4-pyrrolidin-1-ylphenyl)methyl]-2-piperidin-1-yl-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one (PubChem CID 136673329) has the molecular formula C23H30FN5O and a molecular weight of 411.53 g/mol. Its IUPAC name is 7-[(3-fluoro-4-pyrrolidin-1-ylphenyl)methyl]-2-piperidin-1-yl-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 7-[(3-fluoro-4-pyrrolidin-1-ylphenyl)methyl]-2-piperidin-1-yl-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 136673329 |
| Molecular Formula | C23H30FN5O |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | 7-[(3-fluoro-4-pyrrolidin-1-ylphenyl)methyl]-2-piperidin-1-yl-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(N2CCCCC2)nc2c1CCN(Cc1ccc(N3CCCC3)c(F)c1)C2 |
| InChI | InChI=1S/C23H30FN5O/c24-19-14-17(6-7-21(19)28-9-4-5-10-28)15-27-13-8-18-20(16-27)25-23(26-22(18)30)29-11-2-1-3-12-29/h6-7,14H,1-5,8-13,15-16H2,(H,25,26,30) |
| InChIKey | FEJYUHUPXHOCOL-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 55.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|