C26H30N4O3 — CID 136673456
4-[1-[(3,4-dimethoxy-5-prop-2-enylphenyl)methyl]piperidin-4-yl]-2-pyridin-3-yl-1H-pyrimidin-6-one (PubChem CID 136673456) has the molecular formula C26H30N4O3 and a molecular weight of 446.55 g/mol. Its IUPAC name is 4-[1-[(3,4-dimethoxy-5-prop-2-enylphenyl)methyl]piperidin-4-yl]-2-pyridin-3-yl-1H-pyrimidin-6-one.
| Compound Name | 4-[1-[(3,4-dimethoxy-5-prop-2-enylphenyl)methyl]piperidin-4-yl]-2-pyridin-3-yl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136673456 |
| Molecular Formula | C26H30N4O3 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | 4-[1-[(3,4-dimethoxy-5-prop-2-enylphenyl)methyl]piperidin-4-yl]-2-pyridin-3-yl-1H-pyrimidin-6-one |
| SMILES | C=CCc1cc(CN2CCC(c3cc(=O)[nH]c(-c4cccnc4)n3)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C26H30N4O3/c1-4-6-20-13-18(14-23(32-2)25(20)33-3)17-30-11-8-19(9-12-30)22-15-24(31)29-26(28-22)21-7-5-10-27-16-21/h4-5,7,10,13-16,19H,1,6,8-9,11-12,17H2,2-3H3,(H,28,29,31) |
| InChIKey | RHMOCIQZNBUKPQ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|