C19H16FN6NaO7S2 — CID 136674718
sodium (2Z)-2-(2-amino-1,3-thiazol-4-yl)-N-[2-carboxy-3-[(E)-2-[3-(2-fluoroethoxy)-1,2-oxazol-5-yl]ethenyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]-2-hydroxyiminoethanimidate (PubChem CID 136674718) has the molecular formula C19H16FN6NaO7S2 and a molecular weight of 546.49 g/mol. Its IUPAC name is sodium (2Z)-2-(2-amino-1,3-thiazol-4-yl)-N-[2-carboxy-3-[(E)-2-[3-(2-fluoroethoxy)-1,2-oxazol-5-yl]ethenyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]-2-hydroxyiminoethanimidate.
| Compound Name | sodium (2Z)-2-(2-amino-1,3-thiazol-4-yl)-N-[2-carboxy-3-[(E)-2-[3-(2-fluoroethoxy)-1,2-oxazol-5-yl]ethenyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]-2-hydroxyiminoethanimidate |
|---|---|
| PubChem CID | 136674718 |
| Molecular Formula | C19H16FN6NaO7S2 |
| Molecular Weight | 546.49 g/mol |
| Exact Mass | 546.04 |
| IUPAC Name | sodium (2Z)-2-(2-amino-1,3-thiazol-4-yl)-N-[2-carboxy-3-[(E)-2-[3-(2-fluoroethoxy)-1,2-oxazol-5-yl]ethenyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]-2-hydroxyiminoethanimidate |
| SMILES | Nc1nc(C(=N/O)/C([O-])=N/C2C(=O)N3C(C(=O)O)=C(/C=C/c4cc(OCCF)no4)CSC23)cs1.[Na+] |
| InChI | InChI=1S/C19H17FN6O7S2.Na/c20-3-4-32-11-5-9(33-25-11)2-1-8-6-34-17-13(16(28)26(17)14(8)18(29)30)23-15(27)12(24-31)10-7-35-19(21)22-10;/h1-2,5,7,13,17,31H,3-4,6H2,(H2,21,22)(H,23,27)(H,29,30);/q;+1/p-1/b2-1+,24-12-; |
| InChIKey | LKGIIJXTOJKPFO-QBERBUHTSA-M |
| XLogP | -2.66 |
| TPSA | 199.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.49 |
| LogP ≤ 5 | -2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|