C15H16N5NaO6S3 — CID 136864692
sodium (2E)-2-(2-amino-1,3-thiazol-4-yl)-N-[(6R,7R)-2-carboxy-3-(2-methoxyethylsulfanyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]-2-hydroxyiminoethanimidate (PubChem CID 136864692) has the molecular formula C15H16N5NaO6S3 and a molecular weight of 481.51 g/mol. Its IUPAC name is sodium (2E)-2-(2-amino-1,3-thiazol-4-yl)-N-[(6R,7R)-2-carboxy-3-(2-methoxyethylsulfanyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]-2-hydroxyiminoethanimidate.
| Compound Name | sodium (2E)-2-(2-amino-1,3-thiazol-4-yl)-N-[(6R,7R)-2-carboxy-3-(2-methoxyethylsulfanyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]-2-hydroxyiminoethanimidate |
|---|---|
| PubChem CID | 136864692 |
| Molecular Formula | C15H16N5NaO6S3 |
| Molecular Weight | 481.51 g/mol |
| Exact Mass | 481.02 |
| IUPAC Name | sodium (2E)-2-(2-amino-1,3-thiazol-4-yl)-N-[(6R,7R)-2-carboxy-3-(2-methoxyethylsulfanyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]-2-hydroxyiminoethanimidate |
| SMILES | COCCSC1=C(C(=O)O)N2C(=O)[C@@H](/N=C([O-])/C(=N/O)c3csc(N)n3)[C@H]2SC1.[Na+] |
| InChI | InChI=1S/C15H17N5O6S3.Na/c1-26-2-3-27-7-5-28-13-9(12(22)20(13)10(7)14(23)24)18-11(21)8(19-25)6-4-29-15(16)17-6;/h4,9,13,25H,2-3,5H2,1H3,(H2,16,17)(H,18,21)(H,23,24);/q;+1/p-1/b19-8+;/t9-,13-;/m1./s1 |
| InChIKey | ZYTOFAKHHQMZDW-YBACCBCGSA-M |
| XLogP | -3.37 |
| TPSA | 173.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.51 |
| LogP ≤ 5 | -3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|