C16H17N7O5S3 — CID 139701953
(6R)-3-[(E)-2-(1-aminoethylideneamino)ethenyl]sulfanyl-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 139701953) has the molecular formula C16H17N7O5S3 and a molecular weight of 483.56 g/mol. Its IUPAC name is (6R)-3-[(E)-2-(1-aminoethylideneamino)ethenyl]sulfanyl-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R)-3-[(E)-2-(1-aminoethylideneamino)ethenyl]sulfanyl-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 139701953 |
| Molecular Formula | C16H17N7O5S3 |
| Molecular Weight | 483.56 g/mol |
| Exact Mass | 483.05 |
| IUPAC Name | (6R)-3-[(E)-2-(1-aminoethylideneamino)ethenyl]sulfanyl-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | C/C(N)=N\C=C\SC1=C(C(=O)O)N2C(=O)C(NC(=O)/C(=N\O)c3csc(N)n3)[C@H]2SC1 |
| InChI | InChI=1S/C16H17N7O5S3/c1-6(17)19-2-3-29-8-5-30-14-10(13(25)23(14)11(8)15(26)27)21-12(24)9(22-28)7-4-31-16(18)20-7/h2-4,10,14,28H,5H2,1H3,(H2,17,19)(H2,18,20)(H,21,24)(H,26,27)/b3-2+,22-9-/t10?,14-/m1/s1 |
| InChIKey | NDJXAOZGUCOVRK-XBNSIIJDSA-N |
| XLogP | 0.18 |
| TPSA | 196.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.56 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|