C15H13N6NaO6S3 — CID 139701957
sodium (6R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-[(Z)-2-formamidoethenyl]sulfanyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 139701957) has the molecular formula C15H13N6NaO6S3 and a molecular weight of 492.50 g/mol. Its IUPAC name is sodium (6R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-[(Z)-2-formamidoethenyl]sulfanyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | sodium (6R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-[(Z)-2-formamidoethenyl]sulfanyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 139701957 |
| Molecular Formula | C15H13N6NaO6S3 |
| Molecular Weight | 492.50 g/mol |
| Exact Mass | 492.00 |
| IUPAC Name | sodium (6R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-[(Z)-2-formamidoethenyl]sulfanyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | Nc1nc(/C(=N/O)C(=O)NC2C(=O)N3C(C(=O)[O-])=C(S/C=C\NC=O)CS[C@H]23)cs1.[Na+] |
| InChI | InChI=1S/C15H14N6O6S3.Na/c16-15-18-6(3-30-15)8(20-27)11(23)19-9-12(24)21-10(14(25)26)7(4-29-13(9)21)28-2-1-17-5-22;/h1-3,5,9,13,27H,4H2,(H2,16,18)(H,17,22)(H,19,23)(H,25,26);/q;+1/p-1/b2-1-,20-8-;/t9?,13-;/m1./s1 |
| InChIKey | BHTZOKILCWJXMX-RLKFMLTKSA-M |
| XLogP | -4.78 |
| TPSA | 190.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.50 |
| LogP ≤ 5 | -4.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|