C17H15N6NaO5S3 — CID 139702149
sodium (6R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-[(E)-4-cyanobut-1-enyl]sulfanyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 139702149) has the molecular formula C17H15N6NaO5S3 and a molecular weight of 502.54 g/mol. Its IUPAC name is sodium (6R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-[(E)-4-cyanobut-1-enyl]sulfanyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | sodium (6R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-[(E)-4-cyanobut-1-enyl]sulfanyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 139702149 |
| Molecular Formula | C17H15N6NaO5S3 |
| Molecular Weight | 502.54 g/mol |
| Exact Mass | 502.02 |
| IUPAC Name | sodium (6R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-[(E)-4-cyanobut-1-enyl]sulfanyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | N#CCC/C=C/SC1=C(C(=O)[O-])N2C(=O)C(NC(=O)/C(=N\O)c3csc(N)n3)[C@H]2SC1.[Na+] |
| InChI | InChI=1S/C17H16N6O5S3.Na/c18-4-2-1-3-5-29-9-7-30-15-11(14(25)23(15)12(9)16(26)27)21-13(24)10(22-28)8-6-31-17(19)20-8;/h3,5-6,11,15,28H,1-2,7H2,(H2,19,20)(H,21,24)(H,26,27);/q;+1/p-1/b5-3+,22-10-;/t11?,15-;/m1./s1 |
| InChIKey | NNILNQQQJXKMBC-QXTYBADASA-M |
| XLogP | -3.18 |
| TPSA | 184.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.54 |
| LogP ≤ 5 | -3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|