C18H20N6O7S3 — CID 177470902
(6R,7R)-7-[[(2Z)-2-(2-aminoethoxyimino)-2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]-3-[(Z)-3-methoxy-3-oxoprop-1-enyl]sulfanyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 177470902) has the molecular formula C18H20N6O7S3 and a molecular weight of 528.59 g/mol. Its IUPAC name is (6R,7R)-7-[[(2Z)-2-(2-aminoethoxyimino)-2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]-3-[(Z)-3-methoxy-3-oxoprop-1-enyl]sulfanyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R,7R)-7-[[(2Z)-2-(2-aminoethoxyimino)-2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]-3-[(Z)-3-methoxy-3-oxoprop-1-enyl]sulfanyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 177470902 |
| Molecular Formula | C18H20N6O7S3 |
| Molecular Weight | 528.59 g/mol |
| Exact Mass | 528.06 |
| IUPAC Name | (6R,7R)-7-[[(2Z)-2-(2-aminoethoxyimino)-2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]-3-[(Z)-3-methoxy-3-oxoprop-1-enyl]sulfanyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | COC(=O)/C=C\SC1=C(C(=O)O)N2C(=O)[C@@H](NC(=O)/C(=N\OCCN)c3csc(N)n3)[C@H]2SC1 |
| InChI | InChI=1S/C18H20N6O7S3/c1-30-10(25)2-5-32-9-7-33-16-12(15(27)24(16)13(9)17(28)29)22-14(26)11(23-31-4-3-19)8-6-34-18(20)21-8/h2,5-6,12,16H,3-4,7,19H2,1H3,(H2,20,21)(H,22,26)(H,28,29)/b5-2-,23-11-/t12-,16-/m1/s1 |
| InChIKey | JXNIGUMKXXGGHV-DYMOUUKSSA-N |
| XLogP | -0.48 |
| TPSA | 199.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.59 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|