C25H21BrN6O3 — CID 136675965
8-[(2Z)-2-[(5-bromo-2-hydroxyphenyl)methylidene]hydrazinyl]-1,3-dimethyl-7-(naphthalen-1-ylmethyl)purine-2,6-dione (PubChem CID 136675965) has the molecular formula C25H21BrN6O3 and a molecular weight of 533.39 g/mol. Its IUPAC name is 8-[(2Z)-2-[(5-bromo-2-hydroxyphenyl)methylidene]hydrazinyl]-1,3-dimethyl-7-(naphthalen-1-ylmethyl)purine-2,6-dione.
| Compound Name | 8-[(2Z)-2-[(5-bromo-2-hydroxyphenyl)methylidene]hydrazinyl]-1,3-dimethyl-7-(naphthalen-1-ylmethyl)purine-2,6-dione |
|---|---|
| PubChem CID | 136675965 |
| Molecular Formula | C25H21BrN6O3 |
| Molecular Weight | 533.39 g/mol |
| Exact Mass | 532.09 |
| IUPAC Name | 8-[(2Z)-2-[(5-bromo-2-hydroxyphenyl)methylidene]hydrazinyl]-1,3-dimethyl-7-(naphthalen-1-ylmethyl)purine-2,6-dione |
| SMILES | Cn1c(=O)c2c(nc(N/N=C\c3cc(Br)ccc3O)n2Cc2cccc3ccccc23)n(C)c1=O |
| InChI | InChI=1S/C25H21BrN6O3/c1-30-22-21(23(34)31(2)25(30)35)32(14-16-8-5-7-15-6-3-4-9-19(15)16)24(28-22)29-27-13-17-12-18(26)10-11-20(17)33/h3-13,33H,14H2,1-2H3,(H,28,29)/b27-13- |
| InChIKey | ODBIGPWNMPINOJ-WKIKZPBSSA-N |
| XLogP | 3.55 |
| TPSA | 106.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.39 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|