C27H36N4O2 — CID 136679274
(NZ)-N-[1-[3-[[(2Z)-2-hydroxyimino-1-phenylhexylidene]amino]propylimino]-1-phenylhexan-2-ylidene]hydroxylamine (PubChem CID 136679274) has the molecular formula C27H36N4O2 and a molecular weight of 448.61 g/mol. Its IUPAC name is (NZ)-N-[1-[3-[[(2Z)-2-hydroxyimino-1-phenylhexylidene]amino]propylimino]-1-phenylhexan-2-ylidene]hydroxylamine.
| Compound Name | (NZ)-N-[1-[3-[[(2Z)-2-hydroxyimino-1-phenylhexylidene]amino]propylimino]-1-phenylhexan-2-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 136679274 |
| Molecular Formula | C27H36N4O2 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.28 |
| IUPAC Name | (NZ)-N-[1-[3-[[(2Z)-2-hydroxyimino-1-phenylhexylidene]amino]propylimino]-1-phenylhexan-2-ylidene]hydroxylamine |
| SMILES | CCCCC(=N/O)/C(=N\CCC/N=C(C(\CCCC)=N/O)/c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H36N4O2/c1-3-5-18-24(30-32)26(22-14-9-7-10-15-22)28-20-13-21-29-27(23-16-11-8-12-17-23)25(31-33)19-6-4-2/h7-12,14-17,32-33H,3-6,13,18-21H2,1-2H3/b28-26-,29-27-,30-24-,31-25- |
| InChIKey | OHWCIMOVLYMGMK-GDTRBYGKSA-N |
| XLogP | 6.40 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|