C27H17N10+ — CID 136679465
22-methyl-2,11,20,23,25,33,34,35,36-nonaza-22-azoniaoctacyclo[24.6.1.13,10.112,19.121,24.04,9.013,18.027,32]hexatriaconta-1(33),2,4,6,8,10,12(35),13,15,17,19,21,24(34),25,27,29,31-heptadecaene (PubChem CID 136679465) has the molecular formula C27H17N10+ and a molecular weight of 481.50 g/mol. Its IUPAC name is 22-methyl-2,11,20,23,25,33,34,35,36-nonaza-22-azoniaoctacyclo[24.6.1.13,10.112,19.121,24.04,9.013,18.027,32]hexatriaconta-1(33),2,4,6,8,10,12(35),13,15,17,19,21,24(34),25,27,29,31-heptadecaene.
| Compound Name | 22-methyl-2,11,20,23,25,33,34,35,36-nonaza-22-azoniaoctacyclo[24.6.1.13,10.112,19.121,24.04,9.013,18.027,32]hexatriaconta-1(33),2,4,6,8,10,12(35),13,15,17,19,21,24(34),25,27,29,31-heptadecaene |
|---|---|
| PubChem CID | 136679465 |
| Molecular Formula | C27H17N10+ |
| Molecular Weight | 481.50 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | 22-methyl-2,11,20,23,25,33,34,35,36-nonaza-22-azoniaoctacyclo[24.6.1.13,10.112,19.121,24.04,9.013,18.027,32]hexatriaconta-1(33),2,4,6,8,10,12(35),13,15,17,19,21,24(34),25,27,29,31-heptadecaene |
| SMILES | C[n+]1[nH]c2nc1/N=C1/N=C(/N=c3\[nH]/c(c4ccccc34)=N/C3=N/C(=N/2)c2ccccc23)c2ccccc21 |
| InChI | InChI=1S/C27H16N10/c1-37-27-34-25-19-13-7-5-11-17(19)23(32-25)30-21-15-9-3-2-8-14(15)20(28-21)29-22-16-10-4-6-12-18(16)24(31-22)33-26(35-27)36-37/h2-13H,1H3,(H,28,29,30,31,32,33,34,35,36)/p+1 |
| InChIKey | VQLQTCXYZJDIHE-UHFFFAOYSA-O |
| XLogP | 2.35 |
| TPSA | 122.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.50 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|