C44H22N8Sn — CID 172514731
CID 172514731 (PubChem CID 172514731) has the molecular formula C44H22N8Sn and a molecular weight of 781.43 g/mol.
| Compound Name | CID 172514731 |
|---|---|
| PubChem CID | 172514731 |
| Molecular Formula | C44H22N8Sn |
| Molecular Weight | 781.43 g/mol |
| Exact Mass | 782.10 |
| IUPAC Name | — |
| SMILES | [Sn].c1ccc2c(c1)C1=N/C2=N\C2=N/C(=N\C3=N/C(=N\C4=N/C(=N\1)c1ccccc14)c1cc4cc5cc6ccccc6cc5cc4cc13)c1ccccc12 |
| InChI | InChI=1S/C44H22N8.Sn/c1-2-10-24-18-26-20-28-22-36-35(21-27(28)19-25(26)17-23(24)9-1)43-50-41-33-15-7-5-13-31(33)39(48-41)46-37-29-11-3-4-12-30(29)38(45-37)47-40-32-14-6-8-16-34(32)42(49-40)51-44(36)52-43;/h1-22H;/b46-37-,46-39-,47-38+,47-40-,50-41-,50-43-,51-42-,51-44-; |
| InChIKey | XRCAVALNZUVAOP-OXTSOMDESA-N |
| XLogP | 7.91 |
| TPSA | 98.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.43 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|