C23H25N5O3 — CID 136680963
(6aS,9aR)-8-[2-(3-ethyl-4-oxophthalazin-1-yl)acetyl]-2-methyl-5,6,6a,7,9,9a-hexahydro-3H-pyrrolo[3,4-h]quinazolin-4-one (PubChem CID 136680963) has the molecular formula C23H25N5O3 and a molecular weight of 419.49 g/mol. Its IUPAC name is (6aS,9aR)-8-[2-(3-ethyl-4-oxophthalazin-1-yl)acetyl]-2-methyl-5,6,6a,7,9,9a-hexahydro-3H-pyrrolo[3,4-h]quinazolin-4-one.
| Compound Name | (6aS,9aR)-8-[2-(3-ethyl-4-oxophthalazin-1-yl)acetyl]-2-methyl-5,6,6a,7,9,9a-hexahydro-3H-pyrrolo[3,4-h]quinazolin-4-one |
|---|---|
| PubChem CID | 136680963 |
| Molecular Formula | C23H25N5O3 |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | (6aS,9aR)-8-[2-(3-ethyl-4-oxophthalazin-1-yl)acetyl]-2-methyl-5,6,6a,7,9,9a-hexahydro-3H-pyrrolo[3,4-h]quinazolin-4-one |
| SMILES | CCn1nc(CC(=O)N2C[C@H]3CCc4c(nc(C)[nH]c4=O)[C@H]3C2)c2ccccc2c1=O |
| InChI | InChI=1S/C23H25N5O3/c1-3-28-23(31)16-7-5-4-6-15(16)19(26-28)10-20(29)27-11-14-8-9-17-21(18(14)12-27)24-13(2)25-22(17)30/h4-7,14,18H,3,8-12H2,1-2H3,(H,24,25,30)/t14-,18+/m1/s1 |
| InChIKey | PPGXMSCCWHOSHP-KDOFPFPSSA-N |
| XLogP | 1.54 |
| TPSA | 100.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |