C13H14N2O4 — CID 14519538
ethyl 2-[3-(hydroxymethyl)-4-oxophthalazin-1-yl]acetate (PubChem CID 14519538) has the molecular formula C13H14N2O4 and a molecular weight of 262.26 g/mol. Its IUPAC name is ethyl 2-[3-(hydroxymethyl)-4-oxophthalazin-1-yl]acetate.
| Compound Name | ethyl 2-[3-(hydroxymethyl)-4-oxophthalazin-1-yl]acetate |
|---|---|
| PubChem CID | 14519538 |
| Molecular Formula | C13H14N2O4 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | ethyl 2-[3-(hydroxymethyl)-4-oxophthalazin-1-yl]acetate |
| SMILES | CCOC(=O)Cc1nn(CO)c(=O)c2ccccc12 |
| InChI | InChI=1S/C13H14N2O4/c1-2-19-12(17)7-11-9-5-3-4-6-10(9)13(18)15(8-16)14-11/h3-6,16H,2,7-8H2,1H3 |
| InChIKey | QKZQFKKJAHPKCL-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |