C21H18BrFN2O4 — CID 54189022
ethyl 4-[3-[(4-bromo-2-fluorophenyl)methyl]-4-oxophthalazin-1-yl]-3-oxobutanoate (PubChem CID 54189022) has the molecular formula C21H18BrFN2O4 and a molecular weight of 461.29 g/mol. Its IUPAC name is ethyl 4-[3-[(4-bromo-2-fluorophenyl)methyl]-4-oxophthalazin-1-yl]-3-oxobutanoate.
| Compound Name | ethyl 4-[3-[(4-bromo-2-fluorophenyl)methyl]-4-oxophthalazin-1-yl]-3-oxobutanoate |
|---|---|
| PubChem CID | 54189022 |
| Molecular Formula | C21H18BrFN2O4 |
| Molecular Weight | 461.29 g/mol |
| Exact Mass | 460.04 |
| IUPAC Name | ethyl 4-[3-[(4-bromo-2-fluorophenyl)methyl]-4-oxophthalazin-1-yl]-3-oxobutanoate |
| SMILES | CCOC(=O)CC(=O)Cc1nn(Cc2ccc(Br)cc2F)c(=O)c2ccccc12 |
| InChI | InChI=1S/C21H18BrFN2O4/c1-2-29-20(27)11-15(26)10-19-16-5-3-4-6-17(16)21(28)25(24-19)12-13-7-8-14(22)9-18(13)23/h3-9H,2,10-12H2,1H3 |
| InChIKey | PHENJNHRGSVKHG-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.29 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|