C20H16BrFN4O4 — CID 11134548
ethyl 2-[10-[(4-bromo-2-fluorophenyl)methyl]-3,4-dioxo-[1,2,4]triazino[4,3-a]benzimidazol-2-yl]acetate (PubChem CID 11134548) has the molecular formula C20H16BrFN4O4 and a molecular weight of 475.27 g/mol. Its IUPAC name is ethyl 2-[10-[(4-bromo-2-fluorophenyl)methyl]-3,4-dioxo-[1,2,4]triazino[4,3-a]benzimidazol-2-yl]acetate.
| Compound Name | ethyl 2-[10-[(4-bromo-2-fluorophenyl)methyl]-3,4-dioxo-[1,2,4]triazino[4,3-a]benzimidazol-2-yl]acetate |
|---|---|
| PubChem CID | 11134548 |
| Molecular Formula | C20H16BrFN4O4 |
| Molecular Weight | 475.27 g/mol |
| Exact Mass | 474.03 |
| IUPAC Name | ethyl 2-[10-[(4-bromo-2-fluorophenyl)methyl]-3,4-dioxo-[1,2,4]triazino[4,3-a]benzimidazol-2-yl]acetate |
| SMILES | CCOC(=O)Cn1nc2n(Cc3ccc(Br)cc3F)c3ccccc3n2c(=O)c1=O |
| InChI | InChI=1S/C20H16BrFN4O4/c1-2-30-17(27)11-25-18(28)19(29)26-16-6-4-3-5-15(16)24(20(26)23-25)10-12-7-8-13(21)9-14(12)22/h3-9H,2,10-11H2,1H3 |
| InChIKey | ARHFOMFIZMUZHE-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 87.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.27 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|