C14H13FN2O5 — CID 142710325
2-[4-(2-ethoxy-2-oxoethyl)-8-fluoro-1-oxophthalazin-2-yl]acetic acid (PubChem CID 142710325) has the molecular formula C14H13FN2O5 and a molecular weight of 308.27 g/mol. Its IUPAC name is 2-[4-(2-ethoxy-2-oxoethyl)-8-fluoro-1-oxophthalazin-2-yl]acetic acid.
| Compound Name | 2-[4-(2-ethoxy-2-oxoethyl)-8-fluoro-1-oxophthalazin-2-yl]acetic acid |
|---|---|
| PubChem CID | 142710325 |
| Molecular Formula | C14H13FN2O5 |
| Molecular Weight | 308.27 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 2-[4-(2-ethoxy-2-oxoethyl)-8-fluoro-1-oxophthalazin-2-yl]acetic acid |
| SMILES | CCOC(=O)Cc1nn(CC(=O)O)c(=O)c2c(F)cccc12 |
| InChI | InChI=1S/C14H13FN2O5/c1-2-22-12(20)6-10-8-4-3-5-9(15)13(8)14(21)17(16-10)7-11(18)19/h3-5H,2,6-7H2,1H3,(H,18,19) |
| InChIKey | UAVYWQFVKZGRDT-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.27 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |