C21H18F3N3O3S — CID 15713970
ethyl 2-[4-oxo-3-[2-sulfanylidene-2-[3-(trifluoromethyl)anilino]ethyl]phthalazin-1-yl]acetate (PubChem CID 15713970) has the molecular formula C21H18F3N3O3S and a molecular weight of 449.45 g/mol. Its IUPAC name is ethyl 2-[4-oxo-3-[2-sulfanylidene-2-[3-(trifluoromethyl)anilino]ethyl]phthalazin-1-yl]acetate.
| Compound Name | ethyl 2-[4-oxo-3-[2-sulfanylidene-2-[3-(trifluoromethyl)anilino]ethyl]phthalazin-1-yl]acetate |
|---|---|
| PubChem CID | 15713970 |
| Molecular Formula | C21H18F3N3O3S |
| Molecular Weight | 449.45 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | ethyl 2-[4-oxo-3-[2-sulfanylidene-2-[3-(trifluoromethyl)anilino]ethyl]phthalazin-1-yl]acetate |
| SMILES | CCOC(=O)Cc1nn(CC(=S)Nc2cccc(C(F)(F)F)c2)c(=O)c2ccccc12 |
| InChI | InChI=1S/C21H18F3N3O3S/c1-2-30-19(28)11-17-15-8-3-4-9-16(15)20(29)27(26-17)12-18(31)25-14-7-5-6-13(10-14)21(22,23)24/h3-10H,2,11-12H2,1H3,(H,25,31) |
| InChIKey | STSSMOYMDVSXRL-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.45 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|