C13H11F3N2O4 — CID 162731940
methyl 2-[4-(hydroxymethyl)-1-oxo-6-(trifluoromethyl)phthalazin-2-yl]acetate (PubChem CID 162731940) has the molecular formula C13H11F3N2O4 and a molecular weight of 316.24 g/mol. Its IUPAC name is methyl 2-[4-(hydroxymethyl)-1-oxo-6-(trifluoromethyl)phthalazin-2-yl]acetate.
| Compound Name | methyl 2-[4-(hydroxymethyl)-1-oxo-6-(trifluoromethyl)phthalazin-2-yl]acetate |
|---|---|
| PubChem CID | 162731940 |
| Molecular Formula | C13H11F3N2O4 |
| Molecular Weight | 316.24 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | methyl 2-[4-(hydroxymethyl)-1-oxo-6-(trifluoromethyl)phthalazin-2-yl]acetate |
| SMILES | COC(=O)Cn1nc(CO)c2cc(C(F)(F)F)ccc2c1=O |
| InChI | InChI=1S/C13H11F3N2O4/c1-22-11(20)5-18-12(21)8-3-2-7(13(14,15)16)4-9(8)10(6-19)17-18/h2-4,19H,5-6H2,1H3 |
| InChIKey | DVPOIKYWQHMZIF-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.24 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |