C16H17F3N2O4 — CID 162364127
ethyl 2-[4-(1-methoxyethyl)-1-oxo-6-(trifluoromethyl)phthalazin-2-yl]acetate (PubChem CID 162364127) has the molecular formula C16H17F3N2O4 and a molecular weight of 358.32 g/mol. Its IUPAC name is ethyl 2-[4-(1-methoxyethyl)-1-oxo-6-(trifluoromethyl)phthalazin-2-yl]acetate.
| Compound Name | ethyl 2-[4-(1-methoxyethyl)-1-oxo-6-(trifluoromethyl)phthalazin-2-yl]acetate |
|---|---|
| PubChem CID | 162364127 |
| Molecular Formula | C16H17F3N2O4 |
| Molecular Weight | 358.32 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | ethyl 2-[4-(1-methoxyethyl)-1-oxo-6-(trifluoromethyl)phthalazin-2-yl]acetate |
| SMILES | CCOC(=O)Cn1nc(C(C)OC)c2cc(C(F)(F)F)ccc2c1=O |
| InChI | InChI=1S/C16H17F3N2O4/c1-4-25-13(22)8-21-15(23)11-6-5-10(16(17,18)19)7-12(11)14(20-21)9(2)24-3/h5-7,9H,4,8H2,1-3H3 |
| InChIKey | BEUDIEZWTLMCLK-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.32 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |