C17H15F3N6O2 — CID 175639241
2-[4-(dimethylamino)-1-oxo-6-(trifluoromethyl)phthalazin-2-yl]-N-pyrimidin-4-ylacetamide (PubChem CID 175639241) has the molecular formula C17H15F3N6O2 and a molecular weight of 392.34 g/mol. Its IUPAC name is 2-[4-(dimethylamino)-1-oxo-6-(trifluoromethyl)phthalazin-2-yl]-N-pyrimidin-4-ylacetamide.
| Compound Name | 2-[4-(dimethylamino)-1-oxo-6-(trifluoromethyl)phthalazin-2-yl]-N-pyrimidin-4-ylacetamide |
|---|---|
| PubChem CID | 175639241 |
| Molecular Formula | C17H15F3N6O2 |
| Molecular Weight | 392.34 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | 2-[4-(dimethylamino)-1-oxo-6-(trifluoromethyl)phthalazin-2-yl]-N-pyrimidin-4-ylacetamide |
| SMILES | CN(C)c1nn(CC(=O)Nc2ccncn2)c(=O)c2ccc(C(F)(F)F)cc12 |
| InChI | InChI=1S/C17H15F3N6O2/c1-25(2)15-12-7-10(17(18,19)20)3-4-11(12)16(28)26(24-15)8-14(27)23-13-5-6-21-9-22-13/h3-7,9H,8H2,1-2H3,(H,21,22,23,27) |
| InChIKey | YTSXWZXKZYPVFX-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.34 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |