C16H19FN2O3 — CID 163219127
methyl 2-[1-ethyl-7-(2-fluoropropan-2-yl)-4-oxocinnolin-3-yl]acetate (PubChem CID 163219127) has the molecular formula C16H19FN2O3 and a molecular weight of 306.34 g/mol. Its IUPAC name is methyl 2-[1-ethyl-7-(2-fluoropropan-2-yl)-4-oxocinnolin-3-yl]acetate.
| Compound Name | methyl 2-[1-ethyl-7-(2-fluoropropan-2-yl)-4-oxocinnolin-3-yl]acetate |
|---|---|
| PubChem CID | 163219127 |
| Molecular Formula | C16H19FN2O3 |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | methyl 2-[1-ethyl-7-(2-fluoropropan-2-yl)-4-oxocinnolin-3-yl]acetate |
| SMILES | CCn1nc(CC(=O)OC)c(=O)c2ccc(C(C)(C)F)cc21 |
| InChI | InChI=1S/C16H19FN2O3/c1-5-19-13-8-10(16(2,3)17)6-7-11(13)15(21)12(18-19)9-14(20)22-4/h6-8H,5,9H2,1-4H3 |
| InChIKey | DIEFVBKSAARYEK-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |