C12H12N2O4 — CID 90992924
1-ethyl-3-(hydroxymethyl)-[1,3]dioxolo[4,5-g]cinnolin-4-one (PubChem CID 90992924) has the molecular formula C12H12N2O4 and a molecular weight of 248.24 g/mol. Its IUPAC name is 1-ethyl-3-(hydroxymethyl)-[1,3]dioxolo[4,5-g]cinnolin-4-one.
| Compound Name | 1-ethyl-3-(hydroxymethyl)-[1,3]dioxolo[4,5-g]cinnolin-4-one |
|---|---|
| PubChem CID | 90992924 |
| Molecular Formula | C12H12N2O4 |
| Molecular Weight | 248.24 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 1-ethyl-3-(hydroxymethyl)-[1,3]dioxolo[4,5-g]cinnolin-4-one |
| SMILES | CCn1nc(CO)c(=O)c2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C12H12N2O4/c1-2-14-9-4-11-10(17-6-18-11)3-7(9)12(16)8(5-15)13-14/h3-4,15H,2,5-6H2,1H3 |
| InChIKey | VFXVIVPYYQLWNC-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.24 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |