C15H14N2O6 — CID 56975319
2-hydroxyethyl 4-oxo-1-prop-2-enyl-[1,3]dioxolo[4,5-g]cinnoline-3-carboxylate (PubChem CID 56975319) has the molecular formula C15H14N2O6 and a molecular weight of 318.29 g/mol. Its IUPAC name is 2-hydroxyethyl 4-oxo-1-prop-2-enyl-[1,3]dioxolo[4,5-g]cinnoline-3-carboxylate.
| Compound Name | 2-hydroxyethyl 4-oxo-1-prop-2-enyl-[1,3]dioxolo[4,5-g]cinnoline-3-carboxylate |
|---|---|
| PubChem CID | 56975319 |
| Molecular Formula | C15H14N2O6 |
| Molecular Weight | 318.29 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 2-hydroxyethyl 4-oxo-1-prop-2-enyl-[1,3]dioxolo[4,5-g]cinnoline-3-carboxylate |
| SMILES | C=CCn1nc(C(=O)OCCO)c(=O)c2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C15H14N2O6/c1-2-3-17-10-7-12-11(22-8-23-12)6-9(10)14(19)13(16-17)15(20)21-5-4-18/h2,6-7,18H,1,3-5,8H2 |
| InChIKey | BSCMTUDCXMMFHE-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.29 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|