C19H16BrFN2O3 — CID 2821667
ethyl 2-[3-[(4-bromo-2-fluorophenyl)methyl]-4-oxophthalazin-1-yl]acetate (PubChem CID 2821667) has the molecular formula C19H16BrFN2O3 and a molecular weight of 419.25 g/mol. Its IUPAC name is ethyl 2-[3-[(4-bromo-2-fluorophenyl)methyl]-4-oxophthalazin-1-yl]acetate.
| Compound Name | ethyl 2-[3-[(4-bromo-2-fluorophenyl)methyl]-4-oxophthalazin-1-yl]acetate |
|---|---|
| PubChem CID | 2821667 |
| Molecular Formula | C19H16BrFN2O3 |
| Molecular Weight | 419.25 g/mol |
| Exact Mass | 418.03 |
| IUPAC Name | ethyl 2-[3-[(4-bromo-2-fluorophenyl)methyl]-4-oxophthalazin-1-yl]acetate |
| SMILES | CCOC(=O)Cc1nn(Cc2ccc(Br)cc2F)c(=O)c2ccccc12 |
| InChI | InChI=1S/C19H16BrFN2O3/c1-2-26-18(24)10-17-14-5-3-4-6-15(14)19(25)23(22-17)11-12-7-8-13(20)9-16(12)21/h3-9H,2,10-11H2,1H3 |
| InChIKey | CQZZTFWSVOOPJL-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.25 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |