C21H20FN3O2S — CID 136681404
2-[(3R)-1-[2-(4-fluorophenyl)acetyl]piperidin-3-yl]-4-thiophen-3-yl-1H-pyrimidin-6-one (PubChem CID 136681404) has the molecular formula C21H20FN3O2S and a molecular weight of 397.48 g/mol. Its IUPAC name is 2-[(3R)-1-[2-(4-fluorophenyl)acetyl]piperidin-3-yl]-4-thiophen-3-yl-1H-pyrimidin-6-one.
| Compound Name | 2-[(3R)-1-[2-(4-fluorophenyl)acetyl]piperidin-3-yl]-4-thiophen-3-yl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136681404 |
| Molecular Formula | C21H20FN3O2S |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | 2-[(3R)-1-[2-(4-fluorophenyl)acetyl]piperidin-3-yl]-4-thiophen-3-yl-1H-pyrimidin-6-one |
| SMILES | O=C(Cc1ccc(F)cc1)N1CCC[C@@H](c2nc(-c3ccsc3)cc(=O)[nH]2)C1 |
| InChI | InChI=1S/C21H20FN3O2S/c22-17-5-3-14(4-6-17)10-20(27)25-8-1-2-15(12-25)21-23-18(11-19(26)24-21)16-7-9-28-13-16/h3-7,9,11,13,15H,1-2,8,10,12H2,(H,23,24,26)/t15-/m1/s1 |
| InChIKey | JCJPHULWGMVXIG-OAHLLOKOSA-N |
| XLogP | 3.59 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |