C18H18N4O4S2 — CID 136682538
(5R)-5-[2-oxo-2-[4-(6-oxo-4-thiophen-3-yl-1H-pyrimidin-2-yl)piperidin-1-yl]ethyl]-1,3-thiazolidine-2,4-dione (PubChem CID 136682538) has the molecular formula C18H18N4O4S2 and a molecular weight of 418.50 g/mol. Its IUPAC name is (5R)-5-[2-oxo-2-[4-(6-oxo-4-thiophen-3-yl-1H-pyrimidin-2-yl)piperidin-1-yl]ethyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5R)-5-[2-oxo-2-[4-(6-oxo-4-thiophen-3-yl-1H-pyrimidin-2-yl)piperidin-1-yl]ethyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 136682538 |
| Molecular Formula | C18H18N4O4S2 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | (5R)-5-[2-oxo-2-[4-(6-oxo-4-thiophen-3-yl-1H-pyrimidin-2-yl)piperidin-1-yl]ethyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)[C@@H](CC(=O)N2CCC(c3nc(-c4ccsc4)cc(=O)[nH]3)CC2)S1 |
| InChI | InChI=1S/C18H18N4O4S2/c23-14-7-12(11-3-6-27-9-11)19-16(20-14)10-1-4-22(5-2-10)15(24)8-13-17(25)21-18(26)28-13/h3,6-7,9-10,13H,1-2,4-5,8H2,(H,19,20,23)(H,21,25,26)/t13-/m1/s1 |
| InChIKey | FFIGDQPJAHLHCO-CYBMUJFWSA-N |
| XLogP | 1.95 |
| TPSA | 112.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|