C17H17N5O2S2 — CID 136850277
2-[1-(4-methylthiadiazole-5-carbonyl)piperidin-4-yl]-4-thiophen-3-yl-1H-pyrimidin-6-one (PubChem CID 136850277) has the molecular formula C17H17N5O2S2 and a molecular weight of 387.49 g/mol. Its IUPAC name is 2-[1-(4-methylthiadiazole-5-carbonyl)piperidin-4-yl]-4-thiophen-3-yl-1H-pyrimidin-6-one.
| Compound Name | 2-[1-(4-methylthiadiazole-5-carbonyl)piperidin-4-yl]-4-thiophen-3-yl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136850277 |
| Molecular Formula | C17H17N5O2S2 |
| Molecular Weight | 387.49 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | 2-[1-(4-methylthiadiazole-5-carbonyl)piperidin-4-yl]-4-thiophen-3-yl-1H-pyrimidin-6-one |
| SMILES | Cc1nnsc1C(=O)N1CCC(c2nc(-c3ccsc3)cc(=O)[nH]2)CC1 |
| InChI | InChI=1S/C17H17N5O2S2/c1-10-15(26-21-20-10)17(24)22-5-2-11(3-6-22)16-18-13(8-14(23)19-16)12-4-7-25-9-12/h4,7-9,11H,2-3,5-6H2,1H3,(H,18,19,23) |
| InChIKey | WYDLROAZDGUMAE-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.49 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |