C22H23N3O4S — CID 136735444
2-[1-(2,4-dimethoxybenzoyl)piperidin-4-yl]-4-thiophen-3-yl-1H-pyrimidin-6-one (PubChem CID 136735444) has the molecular formula C22H23N3O4S and a molecular weight of 425.51 g/mol. Its IUPAC name is 2-[1-(2,4-dimethoxybenzoyl)piperidin-4-yl]-4-thiophen-3-yl-1H-pyrimidin-6-one.
| Compound Name | 2-[1-(2,4-dimethoxybenzoyl)piperidin-4-yl]-4-thiophen-3-yl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136735444 |
| Molecular Formula | C22H23N3O4S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | 2-[1-(2,4-dimethoxybenzoyl)piperidin-4-yl]-4-thiophen-3-yl-1H-pyrimidin-6-one |
| SMILES | COc1ccc(C(=O)N2CCC(c3nc(-c4ccsc4)cc(=O)[nH]3)CC2)c(OC)c1 |
| InChI | InChI=1S/C22H23N3O4S/c1-28-16-3-4-17(19(11-16)29-2)22(27)25-8-5-14(6-9-25)21-23-18(12-20(26)24-21)15-7-10-30-13-15/h3-4,7,10-14H,5-6,8-9H2,1-2H3,(H,23,24,26) |
| InChIKey | OKAOEQZIRWWREG-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 84.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |