C13H14N2O — CID 136683436
2-[(3,3-dimethylpyrrol-2-yl)methylideneamino]phenol (PubChem CID 136683436) has the molecular formula C13H14N2O and a molecular weight of 214.27 g/mol. Its IUPAC name is 2-[(3,3-dimethylpyrrol-2-yl)methylideneamino]phenol.
| Compound Name | 2-[(3,3-dimethylpyrrol-2-yl)methylideneamino]phenol |
|---|---|
| PubChem CID | 136683436 |
| Molecular Formula | C13H14N2O |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | 2-[(3,3-dimethylpyrrol-2-yl)methylideneamino]phenol |
| SMILES | CC1(C)C=CN=C1/C=N/c1ccccc1O |
| InChI | InChI=1S/C13H14N2O/c1-13(2)7-8-14-12(13)9-15-10-5-3-4-6-11(10)16/h3-9,16H,1-2H3/b15-9+ |
| InChIKey | VCONLFHFNATHHW-OQLLNIDSSA-N |
| XLogP | 3.09 |
| TPSA | 44.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|