C14H16N4O3 — CID 136688065
2-[6-(3-methoxyphenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]acetic acid (PubChem CID 136688065) has the molecular formula C14H16N4O3 and a molecular weight of 288.31 g/mol. Its IUPAC name is 2-[6-(3-methoxyphenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]acetic acid.
| Compound Name | 2-[6-(3-methoxyphenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]acetic acid |
|---|---|
| PubChem CID | 136688065 |
| Molecular Formula | C14H16N4O3 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | 2-[6-(3-methoxyphenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]acetic acid |
| SMILES | COc1cccc(C2CNc3nc(CC(=O)O)nn3C2)c1 |
| InChI | InChI=1S/C14H16N4O3/c1-21-11-4-2-3-9(5-11)10-7-15-14-16-12(6-13(19)20)17-18(14)8-10/h2-5,10H,6-8H2,1H3,(H,19,20)(H,15,16,17) |
| InChIKey | FPVPRCFRCMPWRI-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |