C16H20N4O — CID 136841533
5-(3-methoxyphenyl)-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,8-diene (PubChem CID 136841533) has the molecular formula C16H20N4O and a molecular weight of 284.36 g/mol. Its IUPAC name is 5-(3-methoxyphenyl)-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,8-diene.
| Compound Name | 5-(3-methoxyphenyl)-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,8-diene |
|---|---|
| PubChem CID | 136841533 |
| Molecular Formula | C16H20N4O |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 5-(3-methoxyphenyl)-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,8-diene |
| SMILES | COc1cccc(C2CNc3c4c(nn3C2)NCCC4)c1 |
| InChI | InChI=1S/C16H20N4O/c1-21-13-5-2-4-11(8-13)12-9-18-16-14-6-3-7-17-15(14)19-20(16)10-12/h2,4-5,8,12,18H,3,6-7,9-10H2,1H3,(H,17,19) |
| InChIKey | XHKNGDYGZORWPF-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 51.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |