C25H24N2O5 — CID 136689529
(4S,7R)-4-(2,5-dimethoxyphenyl)-7-(2-hydroxyphenyl)-3-methyl-6,7,8,9-tetrahydro-4H-[1,2]oxazolo[5,4-b]quinolin-5-one (PubChem CID 136689529) has the molecular formula C25H24N2O5 and a molecular weight of 432.48 g/mol. Its IUPAC name is (4S,7R)-4-(2,5-dimethoxyphenyl)-7-(2-hydroxyphenyl)-3-methyl-6,7,8,9-tetrahydro-4H-[1,2]oxazolo[5,4-b]quinolin-5-one.
| Compound Name | (4S,7R)-4-(2,5-dimethoxyphenyl)-7-(2-hydroxyphenyl)-3-methyl-6,7,8,9-tetrahydro-4H-[1,2]oxazolo[5,4-b]quinolin-5-one |
|---|---|
| PubChem CID | 136689529 |
| Molecular Formula | C25H24N2O5 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | (4S,7R)-4-(2,5-dimethoxyphenyl)-7-(2-hydroxyphenyl)-3-methyl-6,7,8,9-tetrahydro-4H-[1,2]oxazolo[5,4-b]quinolin-5-one |
| SMILES | COc1ccc(OC)c([C@@H]2C3=C(C[C@@H](c4ccccc4O)CC3=O)Nc3onc(C)c32)c1 |
| InChI | InChI=1S/C25H24N2O5/c1-13-22-23(17-12-15(30-2)8-9-21(17)31-3)24-18(26-25(22)32-27-13)10-14(11-20(24)29)16-6-4-5-7-19(16)28/h4-9,12,14,23,26,28H,10-11H2,1-3H3/t14-,23+/m1/s1 |
| InChIKey | RDCNYYGMDFXXCQ-FATZIPQQSA-N |
| XLogP | 4.66 |
| TPSA | 93.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |