C23H18Cl2N2O3 — CID 136743560
(4S,7R)-4-(3,4-dichlorophenyl)-7-(2-hydroxyphenyl)-3-methyl-6,7,8,9-tetrahydro-4H-[1,2]oxazolo[5,4-b]quinolin-5-one (PubChem CID 136743560) has the molecular formula C23H18Cl2N2O3 and a molecular weight of 441.31 g/mol. Its IUPAC name is (4S,7R)-4-(3,4-dichlorophenyl)-7-(2-hydroxyphenyl)-3-methyl-6,7,8,9-tetrahydro-4H-[1,2]oxazolo[5,4-b]quinolin-5-one.
| Compound Name | (4S,7R)-4-(3,4-dichlorophenyl)-7-(2-hydroxyphenyl)-3-methyl-6,7,8,9-tetrahydro-4H-[1,2]oxazolo[5,4-b]quinolin-5-one |
|---|---|
| PubChem CID | 136743560 |
| Molecular Formula | C23H18Cl2N2O3 |
| Molecular Weight | 441.31 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | (4S,7R)-4-(3,4-dichlorophenyl)-7-(2-hydroxyphenyl)-3-methyl-6,7,8,9-tetrahydro-4H-[1,2]oxazolo[5,4-b]quinolin-5-one |
| SMILES | Cc1noc2c1[C@H](c1ccc(Cl)c(Cl)c1)C1=C(C[C@@H](c3ccccc3O)CC1=O)N2 |
| InChI | InChI=1S/C23H18Cl2N2O3/c1-11-20-21(12-6-7-15(24)16(25)8-12)22-17(26-23(20)30-27-11)9-13(10-19(22)29)14-4-2-3-5-18(14)28/h2-8,13,21,26,28H,9-10H2,1H3/t13-,21+/m1/s1 |
| InChIKey | AKLUZVOIEKVLJU-ASSNKEHSSA-N |
| XLogP | 5.95 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.31 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |