C10H10N2O2 — CID 136692914
2-ethyl-4-(furan-2-yl)-1H-pyrimidin-6-one (PubChem CID 136692914) has the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. Its IUPAC name is 2-ethyl-4-(furan-2-yl)-1H-pyrimidin-6-one.
| Compound Name | 2-ethyl-4-(furan-2-yl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136692914 |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 2-ethyl-4-(furan-2-yl)-1H-pyrimidin-6-one |
| SMILES | CCc1nc(-c2ccco2)cc(=O)[nH]1 |
| InChI | InChI=1S/C10H10N2O2/c1-2-9-11-7(6-10(13)12-9)8-4-3-5-14-8/h3-6H,2H2,1H3,(H,11,12,13) |
| InChIKey | MHJMXVHRJRFJRA-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |