C15H17N3O2 — CID 135768564
1-butyl-4-(furan-2-yl)-3-methyl-7H-pyrazolo[5,4-b]pyridin-6-one (PubChem CID 135768564) has the molecular formula C15H17N3O2 and a molecular weight of 271.32 g/mol. Its IUPAC name is 1-butyl-4-(furan-2-yl)-3-methyl-7H-pyrazolo[5,4-b]pyridin-6-one.
| Compound Name | 1-butyl-4-(furan-2-yl)-3-methyl-7H-pyrazolo[5,4-b]pyridin-6-one |
|---|---|
| PubChem CID | 135768564 |
| Molecular Formula | C15H17N3O2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | 1-butyl-4-(furan-2-yl)-3-methyl-7H-pyrazolo[5,4-b]pyridin-6-one |
| SMILES | CCCCn1nc(C)c2c(-c3ccco3)cc(=O)[nH]c21 |
| InChI | InChI=1S/C15H17N3O2/c1-3-4-7-18-15-14(10(2)17-18)11(9-13(19)16-15)12-6-5-8-20-12/h5-6,8-9H,3-4,7H2,1-2H3,(H,16,19) |
| InChIKey | AUTWXNXCCCRBDS-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 63.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |