C13H12F2N4O2 — CID 136692944
cis-(1S,2R)-2-(3,4-difluorophenyl)-N-[(5-oxo-1,4-dihydro-1,2,4-triazol-3-yl)methyl]cyclopropane-1-carboxamide (PubChem CID 136692944) has the molecular formula C13H12F2N4O2 and a molecular weight of 294.26 g/mol. Its IUPAC name is cis-(1S,2R)-2-(3,4-difluorophenyl)-N-[(5-oxo-1,4-dihydro-1,2,4-triazol-3-yl)methyl]cyclopropane-1-carboxamide.
| Compound Name | cis-(1S,2R)-2-(3,4-difluorophenyl)-N-[(5-oxo-1,4-dihydro-1,2,4-triazol-3-yl)methyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 136692944 |
| Molecular Formula | C13H12F2N4O2 |
| Molecular Weight | 294.26 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | cis-(1S,2R)-2-(3,4-difluorophenyl)-N-[(5-oxo-1,4-dihydro-1,2,4-triazol-3-yl)methyl]cyclopropane-1-carboxamide |
| SMILES | O=C(NCc1n[nH]c(=O)[nH]1)[C@H]1C[C@H]1c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H12F2N4O2/c14-9-2-1-6(3-10(9)15)7-4-8(7)12(20)16-5-11-17-13(21)19-18-11/h1-3,7-8H,4-5H2,(H,16,20)(H2,17,18,19,21)/t7-,8-/m0/s1 |
| InChIKey | CIXCNWUGOGGIPB-YUMQZZPRSA-N |
| XLogP | 0.80 |
| TPSA | 90.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.26 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |