C14H14BrN5O2 — CID 136694285
4-(5-bromofuran-2-yl)-2-(4-methylpiperazin-1-yl)-6-oxo-1H-pyrimidine-5-carbonitrile (PubChem CID 136694285) has the molecular formula C14H14BrN5O2 and a molecular weight of 364.20 g/mol. Its IUPAC name is 4-(5-bromofuran-2-yl)-2-(4-methylpiperazin-1-yl)-6-oxo-1H-pyrimidine-5-carbonitrile.
| Compound Name | 4-(5-bromofuran-2-yl)-2-(4-methylpiperazin-1-yl)-6-oxo-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 136694285 |
| Molecular Formula | C14H14BrN5O2 |
| Molecular Weight | 364.20 g/mol |
| Exact Mass | 363.03 |
| IUPAC Name | 4-(5-bromofuran-2-yl)-2-(4-methylpiperazin-1-yl)-6-oxo-1H-pyrimidine-5-carbonitrile |
| SMILES | CN1CCN(c2nc(-c3ccc(Br)o3)c(C#N)c(=O)[nH]2)CC1 |
| InChI | InChI=1S/C14H14BrN5O2/c1-19-4-6-20(7-5-19)14-17-12(9(8-16)13(21)18-14)10-2-3-11(15)22-10/h2-3H,4-7H2,1H3,(H,17,18,21) |
| InChIKey | AXIDSMKYQFRNCA-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 89.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.20 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|