C12H12Br4N4 — CID 52935747
4,5,6,7-tetrabromo-2-(4-methylpiperazin-1-yl)-1H-benzimidazole (PubChem CID 52935747) has the molecular formula C12H12Br4N4 and a molecular weight of 531.87 g/mol. Its IUPAC name is 4,5,6,7-tetrabromo-2-(4-methylpiperazin-1-yl)-1H-benzimidazole.
| Compound Name | 4,5,6,7-tetrabromo-2-(4-methylpiperazin-1-yl)-1H-benzimidazole |
|---|---|
| PubChem CID | 52935747 |
| Molecular Formula | C12H12Br4N4 |
| Molecular Weight | 531.87 g/mol |
| Exact Mass | 527.78 |
| IUPAC Name | 4,5,6,7-tetrabromo-2-(4-methylpiperazin-1-yl)-1H-benzimidazole |
| SMILES | CN1CCN(c2nc3c(Br)c(Br)c(Br)c(Br)c3[nH]2)CC1 |
| InChI | InChI=1S/C12H12Br4N4/c1-19-2-4-20(5-3-19)12-17-10-8(15)6(13)7(14)9(16)11(10)18-12/h2-5H2,1H3,(H,17,18) |
| InChIKey | LETIRTMCWFAJRS-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 35.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.87 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|